C21H25ClO2S — CID 88626072
[4-(4-octylsulfanylphenyl)phenyl] carbonochloridate (PubChem CID 88626072) has the molecular formula C21H25ClO2S and a molecular weight of 376.95 g/mol. Its IUPAC name is [4-(4-octylsulfanylphenyl)phenyl] carbonochloridate.
| Compound Name | [4-(4-octylsulfanylphenyl)phenyl] carbonochloridate |
|---|---|
| PubChem CID | 88626072 |
| Molecular Formula | C21H25ClO2S |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [4-(4-octylsulfanylphenyl)phenyl] carbonochloridate |
| SMILES | CCCCCCCCSc1ccc(-c2ccc(OC(=O)Cl)cc2)cc1 |
| InChI | InChI=1S/C21H25ClO2S/c1-2-3-4-5-6-7-16-25-20-14-10-18(11-15-20)17-8-12-19(13-9-17)24-21(22)23/h8-15H,2-7,16H2,1H3 |
| InChIKey | KXVWBCKPGDYXCC-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|