C45H60Cl2N4O4S2 — CID 158114038
[4-(2-heptylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-4-methylpentanoate;[4-(2-hexylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-4-methylpentanoate (PubChem CID 158114038) has the molecular formula C45H60Cl2N4O4S2 and a molecular weight of 856.04 g/mol. Its IUPAC name is [4-(2-heptylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-4-methylpentanoate;[4-(2-hexylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-4-methylpentanoate.
| Compound Name | [4-(2-heptylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-4-methylpentanoate;[4-(2-hexylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-4-methylpentanoate |
|---|---|
| PubChem CID | 158114038 |
| Molecular Formula | C45H60Cl2N4O4S2 |
| Molecular Weight | 856.04 g/mol |
| Exact Mass | 854.34 |
| IUPAC Name | [4-(2-heptylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-4-methylpentanoate;[4-(2-hexylsulfanylpyrimidin-5-yl)phenyl] (2S)-2-chloro-4-methylpentanoate |
| SMILES | CCCCCCCSc1ncc(-c2ccc(OC(=O)[C@@H](Cl)CC(C)C)cc2)cn1.CCCCCCSc1ncc(-c2ccc(OC(=O)[C@@H](Cl)CC(C)C)cc2)cn1 |
| InChI | InChI=1S/C23H31ClN2O2S.C22H29ClN2O2S/c1-4-5-6-7-8-13-29-23-25-15-19(16-26-23)18-9-11-20(12-10-18)28-22(27)21(24)14-17(2)3;1-4-5-6-7-12-28-22-24-14-18(15-25-22)17-8-10-19(11-9-17)27-21(26)20(23)13-16(2)3/h9-12,15-17,21H,4-8,13-14H2,1-3H3;8-11,14-16,20H,4-7,12-13H2,1-3H3/t21-;20-/m00/s1 |
| InChIKey | FQTZGECEMOUDOT-UQMKSMMSSA-N |
| XLogP | 13.14 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.04 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|