C25H36N2O3S — CID 70389112
ethyl (2R)-2-[4-(2-decylsulfanylpyrimidin-5-yl)phenoxy]propanoate (PubChem CID 70389112) has the molecular formula C25H36N2O3S and a molecular weight of 444.64 g/mol. Its IUPAC name is ethyl (2R)-2-[4-(2-decylsulfanylpyrimidin-5-yl)phenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[4-(2-decylsulfanylpyrimidin-5-yl)phenoxy]propanoate |
|---|---|
| PubChem CID | 70389112 |
| Molecular Formula | C25H36N2O3S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | ethyl (2R)-2-[4-(2-decylsulfanylpyrimidin-5-yl)phenoxy]propanoate |
| SMILES | CCCCCCCCCCSc1ncc(-c2ccc(O[C@H](C)C(=O)OCC)cc2)cn1 |
| InChI | InChI=1S/C25H36N2O3S/c1-4-6-7-8-9-10-11-12-17-31-25-26-18-22(19-27-25)21-13-15-23(16-14-21)30-20(3)24(28)29-5-2/h13-16,18-20H,4-12,17H2,1-3H3/t20-/m1/s1 |
| InChIKey | FHYCQLNRTIARFC-HXUWFJFHSA-N |
| XLogP | 6.71 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|