C26H39FN2O2S — CID 18658274
(2S,3R)-1-[4-(2-decylsulfanylpyrimidin-5-yl)phenoxy]-3-fluorohexan-2-ol (PubChem CID 18658274) has the molecular formula C26H39FN2O2S and a molecular weight of 462.68 g/mol. Its IUPAC name is (2S,3R)-1-[4-(2-decylsulfanylpyrimidin-5-yl)phenoxy]-3-fluorohexan-2-ol.
| Compound Name | (2S,3R)-1-[4-(2-decylsulfanylpyrimidin-5-yl)phenoxy]-3-fluorohexan-2-ol |
|---|---|
| PubChem CID | 18658274 |
| Molecular Formula | C26H39FN2O2S |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | (2S,3R)-1-[4-(2-decylsulfanylpyrimidin-5-yl)phenoxy]-3-fluorohexan-2-ol |
| SMILES | CCCCCCCCCCSc1ncc(-c2ccc(OC[C@H](O)[C@H](F)CCC)cc2)cn1 |
| InChI | InChI=1S/C26H39FN2O2S/c1-3-5-6-7-8-9-10-11-17-32-26-28-18-22(19-29-26)21-13-15-23(16-14-21)31-20-25(30)24(27)12-4-2/h13-16,18-19,24-25,30H,3-12,17,20H2,1-2H3/t24-,25+/m1/s1 |
| InChIKey | JBLRPKJDCRPOPI-RPBOFIJWSA-N |
| XLogP | 7.25 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|