C24H34F2N2O2 — CID 18658272
5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-octoxypyrimidine (PubChem CID 18658272) has the molecular formula C24H34F2N2O2 and a molecular weight of 420.54 g/mol. Its IUPAC name is 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-octoxypyrimidine.
| Compound Name | 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-octoxypyrimidine |
|---|---|
| PubChem CID | 18658272 |
| Molecular Formula | C24H34F2N2O2 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 5-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]-2-octoxypyrimidine |
| SMILES | CCCCCCCCOc1ncc(-c2ccc(OC[C@@H](F)[C@H](F)CCC)cc2)cn1 |
| InChI | InChI=1S/C24H34F2N2O2/c1-3-5-6-7-8-9-15-29-24-27-16-20(17-28-24)19-11-13-21(14-12-19)30-18-23(26)22(25)10-4-2/h11-14,16-17,22-23H,3-10,15,18H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | WQCJYAMQCOGJAY-DHIUTWEWSA-N |
| XLogP | 6.74 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|