C28H40F2O2 — CID 58823313
1-[(2S,3S)-2,3-difluorooctoxy]-4-(4-octoxyphenyl)benzene (PubChem CID 58823313) has the molecular formula C28H40F2O2 and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[(2S,3S)-2,3-difluorooctoxy]-4-(4-octoxyphenyl)benzene.
| Compound Name | 1-[(2S,3S)-2,3-difluorooctoxy]-4-(4-octoxyphenyl)benzene |
|---|---|
| PubChem CID | 58823313 |
| Molecular Formula | C28H40F2O2 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 1-[(2S,3S)-2,3-difluorooctoxy]-4-(4-octoxyphenyl)benzene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC[C@H](F)[C@@H](F)CCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H40F2O2/c1-3-5-7-8-9-11-21-31-25-17-13-23(14-18-25)24-15-19-26(20-16-24)32-22-28(30)27(29)12-10-6-4-2/h13-20,27-28H,3-12,21-22H2,1-2H3/t27-,28-/m0/s1 |
| InChIKey | QUGDDVPFMYFUFM-NSOVKSMOSA-N |
| XLogP | 8.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|