C20H25F2NO — CID 71211319
5-[(2R,3R)-2,3-difluorooctoxy]-2-(4-methylphenyl)pyridine (PubChem CID 71211319) has the molecular formula C20H25F2NO and a molecular weight of 333.42 g/mol. Its IUPAC name is 5-[(2R,3R)-2,3-difluorooctoxy]-2-(4-methylphenyl)pyridine.
| Compound Name | 5-[(2R,3R)-2,3-difluorooctoxy]-2-(4-methylphenyl)pyridine |
|---|---|
| PubChem CID | 71211319 |
| Molecular Formula | C20H25F2NO |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 5-[(2R,3R)-2,3-difluorooctoxy]-2-(4-methylphenyl)pyridine |
| SMILES | CCCCC[C@@H](F)[C@H](F)COc1ccc(-c2ccc(C)cc2)nc1 |
| InChI | InChI=1S/C20H25F2NO/c1-3-4-5-6-18(21)19(22)14-24-17-11-12-20(23-13-17)16-9-7-15(2)8-10-16/h7-13,18-19H,3-6,14H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | JDJDXKVGVGSOOT-RTBURBONSA-N |
| XLogP | 5.69 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|