C27H36F2O4 — CID 139672863
[4-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]phenyl] (2R)-2-hexoxypropanoate (PubChem CID 139672863) has the molecular formula C27H36F2O4 and a molecular weight of 462.58 g/mol. Its IUPAC name is [4-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]phenyl] (2R)-2-hexoxypropanoate.
| Compound Name | [4-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]phenyl] (2R)-2-hexoxypropanoate |
|---|---|
| PubChem CID | 139672863 |
| Molecular Formula | C27H36F2O4 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [4-[4-[(2R,3R)-2,3-difluorohexoxy]phenyl]phenyl] (2R)-2-hexoxypropanoate |
| SMILES | CCCCCCO[C@H](C)C(=O)Oc1ccc(-c2ccc(OC[C@@H](F)[C@H](F)CCC)cc2)cc1 |
| InChI | InChI=1S/C27H36F2O4/c1-4-6-7-8-18-31-20(3)27(30)33-24-16-12-22(13-17-24)21-10-14-23(15-11-21)32-19-26(29)25(28)9-5-2/h10-17,20,25-26H,4-9,18-19H2,1-3H3/t20-,25-,26-/m1/s1 |
| InChIKey | YRMVDIPZLHOWIT-LIKDZFNVSA-N |
| XLogP | 7.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|