C34H40O7 — CID 14793532
4-O-[(2S)-octan-2-yl] 1-O-[4-[4-[(2S)-2-propoxypropanoyl]oxyphenyl]phenyl] benzene-1,4-dicarboxylate (PubChem CID 14793532) has the molecular formula C34H40O7 and a molecular weight of 560.69 g/mol. Its IUPAC name is 4-O-[(2S)-octan-2-yl] 1-O-[4-[4-[(2S)-2-propoxypropanoyl]oxyphenyl]phenyl] benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[(2S)-octan-2-yl] 1-O-[4-[4-[(2S)-2-propoxypropanoyl]oxyphenyl]phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 14793532 |
| Molecular Formula | C34H40O7 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 4-O-[(2S)-octan-2-yl] 1-O-[4-[4-[(2S)-2-propoxypropanoyl]oxyphenyl]phenyl] benzene-1,4-dicarboxylate |
| SMILES | CCCCCC[C@H](C)OC(=O)c1ccc(C(=O)Oc2ccc(-c3ccc(OC(=O)[C@H](C)OCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H40O7/c1-5-7-8-9-10-24(3)39-33(36)28-11-13-29(14-12-28)34(37)41-31-21-17-27(18-22-31)26-15-19-30(20-16-26)40-32(35)25(4)38-23-6-2/h11-22,24-25H,5-10,23H2,1-4H3/t24-,25-/m0/s1 |
| InChIKey | LCRFORBMYHVVJJ-DQEYMECFSA-N |
| XLogP | 7.81 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|