C39H50O6 — CID 101100656
[4-(2-methyloctanoyl)phenyl] 4-[4-(2-octoxypropanoyloxy)phenyl]benzoate (PubChem CID 101100656) has the molecular formula C39H50O6 and a molecular weight of 614.82 g/mol. Its IUPAC name is [4-(2-methyloctanoyl)phenyl] 4-[4-(2-octoxypropanoyloxy)phenyl]benzoate.
| Compound Name | [4-(2-methyloctanoyl)phenyl] 4-[4-(2-octoxypropanoyloxy)phenyl]benzoate |
|---|---|
| PubChem CID | 101100656 |
| Molecular Formula | C39H50O6 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | [4-(2-methyloctanoyl)phenyl] 4-[4-(2-octoxypropanoyloxy)phenyl]benzoate |
| SMILES | CCCCCCCCOC(C)C(=O)Oc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)C(C)CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H50O6/c1-5-7-9-11-12-14-28-43-30(4)38(41)44-35-24-20-32(21-25-35)31-16-18-34(19-17-31)39(42)45-36-26-22-33(23-27-36)37(40)29(3)15-13-10-8-6-2/h16-27,29-30H,5-15,28H2,1-4H3 |
| InChIKey | XITKCFHDUDIBFV-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|