C37H46O6 — CID 67843583
4-[(2S)-2-hexoxypropanoyl]oxy-2-[4-[4-[(2R)-2-methyloctanoyl]phenyl]phenyl]benzoic acid (PubChem CID 67843583) has the molecular formula C37H46O6 and a molecular weight of 586.77 g/mol. Its IUPAC name is 4-[(2S)-2-hexoxypropanoyl]oxy-2-[4-[4-[(2R)-2-methyloctanoyl]phenyl]phenyl]benzoic acid.
| Compound Name | 4-[(2S)-2-hexoxypropanoyl]oxy-2-[4-[4-[(2R)-2-methyloctanoyl]phenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67843583 |
| Molecular Formula | C37H46O6 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 4-[(2S)-2-hexoxypropanoyl]oxy-2-[4-[4-[(2R)-2-methyloctanoyl]phenyl]phenyl]benzoic acid |
| SMILES | CCCCCCO[C@@H](C)C(=O)Oc1ccc(C(=O)O)c(-c2ccc(-c3ccc(C(=O)[C@H](C)CCCCCC)cc3)cc2)c1 |
| InChI | InChI=1S/C37H46O6/c1-5-7-9-11-13-26(3)35(38)31-20-16-29(17-21-31)28-14-18-30(19-15-28)34-25-32(22-23-33(34)36(39)40)43-37(41)27(4)42-24-12-10-8-6-2/h14-23,25-27H,5-13,24H2,1-4H3,(H,39,40)/t26-,27+/m1/s1 |
| InChIKey | ZGDLVSFPBLRZQU-SXOMAYOGSA-N |
| XLogP | 9.40 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|