C38H50O5 — CID 67913780
4-decanoyloxybenzoic acid;2-methyl-1-(4-phenylphenyl)octan-1-one (PubChem CID 67913780) has the molecular formula C38H50O5 and a molecular weight of 586.81 g/mol. Its IUPAC name is 4-decanoyloxybenzoic acid;2-methyl-1-(4-phenylphenyl)octan-1-one.
| Compound Name | 4-decanoyloxybenzoic acid;2-methyl-1-(4-phenylphenyl)octan-1-one |
|---|---|
| PubChem CID | 67913780 |
| Molecular Formula | C38H50O5 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | 4-decanoyloxybenzoic acid;2-methyl-1-(4-phenylphenyl)octan-1-one |
| SMILES | CCCCCCC(C)C(=O)c1ccc(-c2ccccc2)cc1.CCCCCCCCCC(=O)Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H26O.C17H24O4/c1-3-4-5-7-10-17(2)21(22)20-15-13-19(14-16-20)18-11-8-6-9-12-18;1-2-3-4-5-6-7-8-9-16(18)21-15-12-10-14(11-13-15)17(19)20/h6,8-9,11-17H,3-5,7,10H2,1-2H3;10-13H,2-9H2,1H3,(H,19,20) |
| InChIKey | MFIZJPDXDLFDNG-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|