About octan-2-yl 4-(4-octanoyloxyphenyl)benzoate
octan-2-yl 4-(4-octanoyloxyphenyl)benzoate (PubChem CID 54442503) has the molecular formula C29H40O4
and a molecular weight of 452.64 g/mol. Its IUPAC name is octan-2-yl 4-(4-octanoyloxyphenyl)benzoate.
Molecular Properties
| Compound Name | octan-2-yl 4-(4-octanoyloxyphenyl)benzoate |
| PubChem CID | 54442503 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | octan-2-yl 4-(4-octanoyloxyphenyl)benzoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(-c2ccc(C(=O)OC(C)CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C29H40O4/c1-4-6-8-10-12-14-28(30)33-27-21-19-25(20-22-27)24-15-17-26(18-16-24)29(31)32-23(3)13-11-9-7-5-2/h15-23H,4-14H2,1-3H3 |
| InChIKey | WPCSILXDRASXPT-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl 4-(4-octanoyloxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl 4-(4-octanoyloxyphenyl)benzoate?
The IUPAC name of octan-2-yl 4-(4-octanoyloxyphenyl)benzoate (CID 54442503) is octan-2-yl 4-(4-octanoyloxyphenyl)benzoate.
What is the SMILES notation for octan-2-yl 4-(4-octanoyloxyphenyl)benzoate?
The canonical SMILES for octan-2-yl 4-(4-octanoyloxyphenyl)benzoate is CCCCCCCC(=O)Oc1ccc(-c2ccc(C(=O)OC(C)CCCCCC)cc2)cc1.
What is the InChIKey of octan-2-yl 4-(4-octanoyloxyphenyl)benzoate?
The InChIKey is WPCSILXDRASXPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H40O4/c1-4-6-8-10-12-14-28(30)33-27-21-19-25(20-22-27)24-15-17-26(18-16-24)29(31)32-23(3)13-11-9-7-5-2/h15-23H,4-14H2,1-3H3.
What are the key properties of octan-2-yl 4-(4-octanoyloxyphenyl)benzoate?
octan-2-yl 4-(4-octanoyloxyphenyl)benzoate has a molecular weight of 452.64 g/mol, XLogP of 8.14, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl 4-(4-octanoyloxyphenyl)benzoate is sourced from PubChem (CID 54442503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).