C39H52O5 — CID 102152096
[(2S)-octan-2-yl] 4-[4-[4-(6-hexanoyloxyhexoxy)phenyl]phenyl]benzoate (PubChem CID 102152096) has the molecular formula C39H52O5 and a molecular weight of 600.84 g/mol. Its IUPAC name is [(2S)-octan-2-yl] 4-[4-[4-(6-hexanoyloxyhexoxy)phenyl]phenyl]benzoate.
| Compound Name | [(2S)-octan-2-yl] 4-[4-[4-(6-hexanoyloxyhexoxy)phenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 102152096 |
| Molecular Formula | C39H52O5 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | [(2S)-octan-2-yl] 4-[4-[4-(6-hexanoyloxyhexoxy)phenyl]phenyl]benzoate |
| SMILES | CCCCCC[C@H](C)OC(=O)c1ccc(-c2ccc(-c3ccc(OCCCCCCOC(=O)CCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H52O5/c1-4-6-8-12-15-31(3)44-39(41)36-23-21-34(22-24-36)32-17-19-33(20-18-32)35-25-27-37(28-26-35)42-29-13-9-10-14-30-43-38(40)16-11-7-5-2/h17-28,31H,4-16,29-30H2,1-3H3/t31-/m0/s1 |
| InChIKey | WGZMWYFRWDNLOQ-HKBQPEDESA-N |
| XLogP | 10.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|