C37H48O5 — CID 67913779
2-methyl-1-(4-phenylphenyl)octan-1-one;4-nonanoyloxybenzoic acid (PubChem CID 67913779) has the molecular formula C37H48O5 and a molecular weight of 572.79 g/mol. Its IUPAC name is 2-methyl-1-(4-phenylphenyl)octan-1-one;4-nonanoyloxybenzoic acid.
| Compound Name | 2-methyl-1-(4-phenylphenyl)octan-1-one;4-nonanoyloxybenzoic acid |
|---|---|
| PubChem CID | 67913779 |
| Molecular Formula | C37H48O5 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | 2-methyl-1-(4-phenylphenyl)octan-1-one;4-nonanoyloxybenzoic acid |
| SMILES | CCCCCCC(C)C(=O)c1ccc(-c2ccccc2)cc1.CCCCCCCCC(=O)Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H26O.C16H22O4/c1-3-4-5-7-10-17(2)21(22)20-15-13-19(14-16-20)18-11-8-6-9-12-18;1-2-3-4-5-6-7-8-15(17)20-14-11-9-13(10-12-14)16(18)19/h6,8-9,11-17H,3-5,7,10H2,1-2H3;9-12H,2-8H2,1H3,(H,18,19) |
| InChIKey | RYULFAQDAGIIQN-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|