C30H42O4 — CID 67915078
2-[4-(2-methyloctanoyl)phenyl]-4-octoxybenzoic acid (PubChem CID 67915078) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is 2-[4-(2-methyloctanoyl)phenyl]-4-octoxybenzoic acid.
| Compound Name | 2-[4-(2-methyloctanoyl)phenyl]-4-octoxybenzoic acid |
|---|---|
| PubChem CID | 67915078 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 2-[4-(2-methyloctanoyl)phenyl]-4-octoxybenzoic acid |
| SMILES | CCCCCCCCOc1ccc(C(=O)O)c(-c2ccc(C(=O)C(C)CCCCCC)cc2)c1 |
| InChI | InChI=1S/C30H42O4/c1-4-6-8-10-11-13-21-34-26-19-20-27(30(32)33)28(22-26)24-15-17-25(18-16-24)29(31)23(3)14-12-9-7-5-2/h15-20,22-23H,4-14,21H2,1-3H3,(H,32,33) |
| InChIKey | XWDJZIGPJJZRLB-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|