C34H40O6-2 — CID 57357640
2-[4-(2-carboxylato-5-heptoxyphenyl)phenyl]-4-heptoxybenzoate (PubChem CID 57357640) has the molecular formula C34H40O6-2 and a molecular weight of 544.69 g/mol. Its IUPAC name is 2-[4-(2-carboxylato-5-heptoxyphenyl)phenyl]-4-heptoxybenzoate.
| Compound Name | 2-[4-(2-carboxylato-5-heptoxyphenyl)phenyl]-4-heptoxybenzoate |
|---|---|
| PubChem CID | 57357640 |
| Molecular Formula | C34H40O6-2 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | 2-[4-(2-carboxylato-5-heptoxyphenyl)phenyl]-4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)[O-])c(-c2ccc(-c3cc(OCCCCCCC)ccc3C(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C34H42O6/c1-3-5-7-9-11-21-39-27-17-19-29(33(35)36)31(23-27)25-13-15-26(16-14-25)32-24-28(18-20-30(32)34(37)38)40-22-12-10-8-6-4-2/h13-20,23-24H,3-12,21-22H2,1-2H3,(H,35,36)(H,37,38)/p-2 |
| InChIKey | WMRLCAKKZFIXMB-UHFFFAOYSA-L |
| XLogP | 6.45 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|