C28H37ClO5 — CID 18660635
2-[4-[(2S)-2-chloro-3-methylbutanoyl]oxyphenyl]-4-decoxybenzoic acid (PubChem CID 18660635) has the molecular formula C28H37ClO5 and a molecular weight of 489.05 g/mol. Its IUPAC name is 2-[4-[(2S)-2-chloro-3-methylbutanoyl]oxyphenyl]-4-decoxybenzoic acid.
| Compound Name | 2-[4-[(2S)-2-chloro-3-methylbutanoyl]oxyphenyl]-4-decoxybenzoic acid |
|---|---|
| PubChem CID | 18660635 |
| Molecular Formula | C28H37ClO5 |
| Molecular Weight | 489.05 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 2-[4-[(2S)-2-chloro-3-methylbutanoyl]oxyphenyl]-4-decoxybenzoic acid |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)O)c(-c2ccc(OC(=O)[C@@H](Cl)C(C)C)cc2)c1 |
| InChI | InChI=1S/C28H37ClO5/c1-4-5-6-7-8-9-10-11-18-33-23-16-17-24(27(30)31)25(19-23)21-12-14-22(15-13-21)34-28(32)26(29)20(2)3/h12-17,19-20,26H,4-11,18H2,1-3H3,(H,30,31)/t26-/m0/s1 |
| InChIKey | IPWVDTLYFRNPGJ-SANMLTNESA-N |
| XLogP | 7.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.05 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|