C23H30O3 — CID 67863047
4-pentoxy-2-(4-pentylphenyl)benzoic acid (PubChem CID 67863047) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 4-pentoxy-2-(4-pentylphenyl)benzoic acid.
| Compound Name | 4-pentoxy-2-(4-pentylphenyl)benzoic acid |
|---|---|
| PubChem CID | 67863047 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 4-pentoxy-2-(4-pentylphenyl)benzoic acid |
| SMILES | CCCCCOc1ccc(C(=O)O)c(-c2ccc(CCCCC)cc2)c1 |
| InChI | InChI=1S/C23H30O3/c1-3-5-7-9-18-10-12-19(13-11-18)22-17-20(26-16-8-6-4-2)14-15-21(22)23(24)25/h10-15,17H,3-9,16H2,1-2H3,(H,24,25) |
| InChIKey | SXLIEIUKYTXPBX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|