C24H22F2O3 — CID 67865739
2-[4-(4-butylphenyl)phenyl]-4-(difluoromethoxy)benzoic acid (PubChem CID 67865739) has the molecular formula C24H22F2O3 and a molecular weight of 396.43 g/mol. Its IUPAC name is 2-[4-(4-butylphenyl)phenyl]-4-(difluoromethoxy)benzoic acid.
| Compound Name | 2-[4-(4-butylphenyl)phenyl]-4-(difluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 67865739 |
| Molecular Formula | C24H22F2O3 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[4-(4-butylphenyl)phenyl]-4-(difluoromethoxy)benzoic acid |
| SMILES | CCCCc1ccc(-c2ccc(-c3cc(OC(F)F)ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H22F2O3/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)22-15-20(29-24(25)26)13-14-21(22)23(27)28/h5-15,24H,2-4H2,1H3,(H,27,28) |
| InChIKey | YEQRPZCENXPBLZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |