C26H26F2O2 — CID 158231755
4-(2,4-difluorophenyl)-2-(4-heptylphenyl)benzoic acid (PubChem CID 158231755) has the molecular formula C26H26F2O2 and a molecular weight of 408.49 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-2-(4-heptylphenyl)benzoic acid.
| Compound Name | 4-(2,4-difluorophenyl)-2-(4-heptylphenyl)benzoic acid |
|---|---|
| PubChem CID | 158231755 |
| Molecular Formula | C26H26F2O2 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-(2,4-difluorophenyl)-2-(4-heptylphenyl)benzoic acid |
| SMILES | CCCCCCCc1ccc(-c2cc(-c3ccc(F)cc3F)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H26F2O2/c1-2-3-4-5-6-7-18-8-10-19(11-9-18)24-16-20(12-14-23(24)26(29)30)22-15-13-21(27)17-25(22)28/h8-17H,2-7H2,1H3,(H,29,30) |
| InChIKey | PNRJGHAPCPTDNB-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|