C20H24F2 — CID 56633566
2,4-difluoro-1-(4-octylphenyl)benzene (PubChem CID 56633566) has the molecular formula C20H24F2 and a molecular weight of 302.41 g/mol. Its IUPAC name is 2,4-difluoro-1-(4-octylphenyl)benzene.
| Compound Name | 2,4-difluoro-1-(4-octylphenyl)benzene |
|---|---|
| PubChem CID | 56633566 |
| Molecular Formula | C20H24F2 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 2,4-difluoro-1-(4-octylphenyl)benzene |
| SMILES | CCCCCCCCc1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H24F2/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)19-14-13-18(21)15-20(19)22/h9-15H,2-8H2,1H3 |
| InChIKey | NRBIPUUNFUJVMF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|