About 2-(4-octylphenyl)benzoic acid
2-(4-octylphenyl)benzoic acid (PubChem CID 23035037) has the molecular formula C21H26O2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(4-octylphenyl)benzoic acid.
Molecular Properties
| Compound Name | 2-(4-octylphenyl)benzoic acid |
| PubChem CID | 23035037 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-(4-octylphenyl)benzoic acid |
| SMILES | CCCCCCCCc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H26O2/c1-2-3-4-5-6-7-10-17-13-15-18(16-14-17)19-11-8-9-12-20(19)21(22)23/h8-9,11-16H,2-7,10H2,1H3,(H,22,23) |
| InChIKey | YHCXNFNVMRZOHL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-octylphenyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-octylphenyl)benzoic acid?
The IUPAC name of 2-(4-octylphenyl)benzoic acid (CID 23035037) is 2-(4-octylphenyl)benzoic acid.
What is the SMILES notation for 2-(4-octylphenyl)benzoic acid?
The canonical SMILES for 2-(4-octylphenyl)benzoic acid is CCCCCCCCc1ccc(-c2ccccc2C(=O)O)cc1.
What is the InChIKey of 2-(4-octylphenyl)benzoic acid?
The InChIKey is YHCXNFNVMRZOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O2/c1-2-3-4-5-6-7-10-17-13-15-18(16-14-17)19-11-8-9-12-20(19)21(22)23/h8-9,11-16H,2-7,10H2,1H3,(H,22,23).
What are the key properties of 2-(4-octylphenyl)benzoic acid?
2-(4-octylphenyl)benzoic acid has a molecular weight of 310.44 g/mol, XLogP of 5.95, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-octylphenyl)benzoic acid is sourced from PubChem (CID 23035037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).