C25H30N2O3 — CID 54089277
2-[4-[(3-ethyl-5-hexyl-2-oxo-1H-imidazol-4-yl)methyl]phenyl]benzoic acid (PubChem CID 54089277) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[4-[(3-ethyl-5-hexyl-2-oxo-1H-imidazol-4-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(3-ethyl-5-hexyl-2-oxo-1H-imidazol-4-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 54089277 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 2-[4-[(3-ethyl-5-hexyl-2-oxo-1H-imidazol-4-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCCCc1[nH]c(=O)n(CC)c1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-3-5-6-7-12-22-23(27(4-2)25(30)26-22)17-18-13-15-19(16-14-18)20-10-8-9-11-21(20)24(28)29/h8-11,13-16H,3-7,12,17H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | MSRZIXSIMQNNEO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|