C27H33FN2O3 — CID 19741148
2-[4-[[5-butyl-4-(fluoromethyl)-2-oxo-3-pentylimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 19741148) has the molecular formula C27H33FN2O3 and a molecular weight of 452.57 g/mol. Its IUPAC name is 2-[4-[[5-butyl-4-(fluoromethyl)-2-oxo-3-pentylimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-butyl-4-(fluoromethyl)-2-oxo-3-pentylimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19741148 |
| Molecular Formula | C27H33FN2O3 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-[4-[[5-butyl-4-(fluoromethyl)-2-oxo-3-pentylimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCCn1c(CF)c(CCCC)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c1=O |
| InChI | InChI=1S/C27H33FN2O3/c1-3-5-9-17-29-25(18-28)24(12-6-4-2)30(27(29)33)19-20-13-15-21(16-14-20)22-10-7-8-11-23(22)26(31)32/h7-8,10-11,13-16H,3-6,9,12,17-19H2,1-2H3,(H,31,32) |
| InChIKey | KGAZLLICKQKBIK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|