C27H31FN2O3 — CID 19741614
2-[4-[(5-butyl-3-cyclohexyl-4-fluoro-2-oxoimidazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 19741614) has the molecular formula C27H31FN2O3 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-[4-[(5-butyl-3-cyclohexyl-4-fluoro-2-oxoimidazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(5-butyl-3-cyclohexyl-4-fluoro-2-oxoimidazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19741614 |
| Molecular Formula | C27H31FN2O3 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[4-[(5-butyl-3-cyclohexyl-4-fluoro-2-oxoimidazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCc1c(F)n(C2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H31FN2O3/c1-2-3-13-24-25(28)30(21-9-5-4-6-10-21)27(33)29(24)18-19-14-16-20(17-15-19)22-11-7-8-12-23(22)26(31)32/h7-8,11-12,14-17,21H,2-6,9-10,13,18H2,1H3,(H,31,32) |
| InChIKey | ZZQOENQJJKGSPY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |