C31H38N2O6 — CID 19741202
2-[4-[[5-butyl-3-(cyclohexanecarbonyl)-4-(dimethoxymethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 19741202) has the molecular formula C31H38N2O6 and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-[4-[[5-butyl-3-(cyclohexanecarbonyl)-4-(dimethoxymethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-butyl-3-(cyclohexanecarbonyl)-4-(dimethoxymethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19741202 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 2-[4-[[5-butyl-3-(cyclohexanecarbonyl)-4-(dimethoxymethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCc1c(C(OC)OC)n(C(=O)C2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H38N2O6/c1-4-5-15-26-27(30(38-2)39-3)33(28(34)23-11-7-6-8-12-23)31(37)32(26)20-21-16-18-22(19-17-21)24-13-9-10-14-25(24)29(35)36/h9-10,13-14,16-19,23,30H,4-8,11-12,15,20H2,1-3H3,(H,35,36) |
| InChIKey | QBVCHKGGMGSPOI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|