C32H34N2O6 — CID 67910453
5-[[5-butyl-4-(dimethoxymethyl)-2-oxo-3-(2-phenylacetyl)imidazol-1-yl]methyl]-2-phenylbenzoic acid (PubChem CID 67910453) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is 5-[[5-butyl-4-(dimethoxymethyl)-2-oxo-3-(2-phenylacetyl)imidazol-1-yl]methyl]-2-phenylbenzoic acid.
| Compound Name | 5-[[5-butyl-4-(dimethoxymethyl)-2-oxo-3-(2-phenylacetyl)imidazol-1-yl]methyl]-2-phenylbenzoic acid |
|---|---|
| PubChem CID | 67910453 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 5-[[5-butyl-4-(dimethoxymethyl)-2-oxo-3-(2-phenylacetyl)imidazol-1-yl]methyl]-2-phenylbenzoic acid |
| SMILES | CCCCc1c(C(OC)OC)n(C(=O)Cc2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H34N2O6/c1-4-5-16-27-29(31(39-2)40-3)34(28(35)20-22-12-8-6-9-13-22)32(38)33(27)21-23-17-18-25(26(19-23)30(36)37)24-14-10-7-11-15-24/h6-15,17-19,31H,4-5,16,20-21H2,1-3H3,(H,36,37) |
| InChIKey | ISGKBSBJPCDDCF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|