C31H40N2O5 — CID 19741083
2-[4-[[5-butyl-3-(cyclohexylmethyl)-4-(dimethoxymethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 19741083) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is 2-[4-[[5-butyl-3-(cyclohexylmethyl)-4-(dimethoxymethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-butyl-3-(cyclohexylmethyl)-4-(dimethoxymethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19741083 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 2-[4-[[5-butyl-3-(cyclohexylmethyl)-4-(dimethoxymethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCc1c(C(OC)OC)n(CC2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H40N2O5/c1-4-5-15-27-28(30(37-2)38-3)33(21-22-11-7-6-8-12-22)31(36)32(27)20-23-16-18-24(19-17-23)25-13-9-10-14-26(25)29(34)35/h9-10,13-14,16-19,22,30H,4-8,11-12,15,20-21H2,1-3H3,(H,34,35) |
| InChIKey | UEHWVGCZDBJPCJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|