C27H32N2O3 — CID 19740525
2-[4-[(3-cyclohexyl-4-methyl-2-oxo-5-propylimidazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 19740525) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-[4-[(3-cyclohexyl-4-methyl-2-oxo-5-propylimidazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(3-cyclohexyl-4-methyl-2-oxo-5-propylimidazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19740525 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-[4-[(3-cyclohexyl-4-methyl-2-oxo-5-propylimidazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCc1c(C)n(C2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H32N2O3/c1-3-9-25-19(2)29(22-10-5-4-6-11-22)27(32)28(25)18-20-14-16-21(17-15-20)23-12-7-8-13-24(23)26(30)31/h7-8,12-17,22H,3-6,9-11,18H2,1-2H3,(H,30,31) |
| InChIKey | TXUSPSGJRFIINX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |