C27H32N2O4 — CID 19740351
2-[4-[(5-butyl-4-methyl-2-oxo-3-pentanoylimidazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 19740351) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 2-[4-[(5-butyl-4-methyl-2-oxo-3-pentanoylimidazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(5-butyl-4-methyl-2-oxo-3-pentanoylimidazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19740351 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 2-[4-[(5-butyl-4-methyl-2-oxo-3-pentanoylimidazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCC(=O)n1c(C)c(CCCC)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c1=O |
| InChI | InChI=1S/C27H32N2O4/c1-4-6-12-24-19(3)29(25(30)13-7-5-2)27(33)28(24)18-20-14-16-21(17-15-20)22-10-8-9-11-23(22)26(31)32/h8-11,14-17H,4-7,12-13,18H2,1-3H3,(H,31,32) |
| InChIKey | MISZSDVCRYNFML-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |