C28H25FN2O4 — CID 19741100
2-[4-[(3-benzoyl-5-butyl-4-fluoro-2-oxoimidazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 19741100) has the molecular formula C28H25FN2O4 and a molecular weight of 472.52 g/mol. Its IUPAC name is 2-[4-[(3-benzoyl-5-butyl-4-fluoro-2-oxoimidazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(3-benzoyl-5-butyl-4-fluoro-2-oxoimidazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19741100 |
| Molecular Formula | C28H25FN2O4 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-[4-[(3-benzoyl-5-butyl-4-fluoro-2-oxoimidazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCc1c(F)n(C(=O)c2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C28H25FN2O4/c1-2-3-13-24-25(29)31(26(32)21-9-5-4-6-10-21)28(35)30(24)18-19-14-16-20(17-15-19)22-11-7-8-12-23(22)27(33)34/h4-12,14-17H,2-3,13,18H2,1H3,(H,33,34) |
| InChIKey | KHNPBGKMEVTTDA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |