C29H27FN2O4 — CID 19740119
2-[4-[[3-benzoyl-5-butyl-4-(fluoromethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 19740119) has the molecular formula C29H27FN2O4 and a molecular weight of 486.54 g/mol. Its IUPAC name is 2-[4-[[3-benzoyl-5-butyl-4-(fluoromethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[3-benzoyl-5-butyl-4-(fluoromethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19740119 |
| Molecular Formula | C29H27FN2O4 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-[4-[[3-benzoyl-5-butyl-4-(fluoromethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCc1c(CF)n(C(=O)c2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H27FN2O4/c1-2-3-13-25-26(18-30)32(27(33)22-9-5-4-6-10-22)29(36)31(25)19-20-14-16-21(17-15-20)23-11-7-8-12-24(23)28(34)35/h4-12,14-17H,2-3,13,18-19H2,1H3,(H,34,35) |
| InChIKey | OMROUGOSNYZPEJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |