C27H34N2O5 — CID 19740106
2-[4-[[3-butan-2-yl-4-(dimethoxymethyl)-2-oxo-5-propylimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 19740106) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[4-[[3-butan-2-yl-4-(dimethoxymethyl)-2-oxo-5-propylimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[3-butan-2-yl-4-(dimethoxymethyl)-2-oxo-5-propylimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19740106 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 2-[4-[[3-butan-2-yl-4-(dimethoxymethyl)-2-oxo-5-propylimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCc1c(C(OC)OC)n(C(C)CC)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H34N2O5/c1-6-10-23-24(26(33-4)34-5)29(18(3)7-2)27(32)28(23)17-19-13-15-20(16-14-19)21-11-8-9-12-22(21)25(30)31/h8-9,11-16,18,26H,6-7,10,17H2,1-5H3,(H,30,31) |
| InChIKey | LRRGYDHYLSXGSC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|