C30H38N6O4 — CID 19740795
5-(dimethoxymethyl)-4-(3-methylbutyl)-1-pentanoyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one (PubChem CID 19740795) has the molecular formula C30H38N6O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is 5-(dimethoxymethyl)-4-(3-methylbutyl)-1-pentanoyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 5-(dimethoxymethyl)-4-(3-methylbutyl)-1-pentanoyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 19740795 |
| Molecular Formula | C30H38N6O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 5-(dimethoxymethyl)-4-(3-methylbutyl)-1-pentanoyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
| SMILES | CCCCC(=O)n1c(C(OC)OC)c(CCC(C)C)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c1=O |
| InChI | InChI=1S/C30H38N6O4/c1-6-7-12-26(37)36-27(29(39-4)40-5)25(18-13-20(2)3)35(30(36)38)19-21-14-16-22(17-15-21)23-10-8-9-11-24(23)28-31-33-34-32-28/h8-11,14-17,20,29H,6-7,12-13,18-19H2,1-5H3,(H,31,32,33,34) |
| InChIKey | JFWZREPUECRWTJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|