C31H34N6O3 — CID 19741532
5-(dimethoxymethyl)-1-(2-phenylethyl)-4-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one (PubChem CID 19741532) has the molecular formula C31H34N6O3 and a molecular weight of 538.65 g/mol. Its IUPAC name is 5-(dimethoxymethyl)-1-(2-phenylethyl)-4-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 5-(dimethoxymethyl)-1-(2-phenylethyl)-4-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 19741532 |
| Molecular Formula | C31H34N6O3 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 5-(dimethoxymethyl)-1-(2-phenylethyl)-4-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
| SMILES | CCCc1c(C(OC)OC)n(CCc2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H34N6O3/c1-4-10-27-28(30(39-2)40-3)36(20-19-22-11-6-5-7-12-22)31(38)37(27)21-23-15-17-24(18-16-23)25-13-8-9-14-26(25)29-32-34-35-33-29/h5-9,11-18,30H,4,10,19-21H2,1-3H3,(H,32,33,34,35) |
| InChIKey | HHVGDHHHNKGRSC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|