C33H44N6O3 — CID 19740858
1-(2-cyclohexylethyl)-5-(dimethoxymethyl)-4-(3-methylbutyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one (PubChem CID 19740858) has the molecular formula C33H44N6O3 and a molecular weight of 572.75 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-5-(dimethoxymethyl)-4-(3-methylbutyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 1-(2-cyclohexylethyl)-5-(dimethoxymethyl)-4-(3-methylbutyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 19740858 |
| Molecular Formula | C33H44N6O3 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | 1-(2-cyclohexylethyl)-5-(dimethoxymethyl)-4-(3-methylbutyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
| SMILES | COC(OC)c1c(CCC(C)C)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c(=O)n1CCC1CCCCC1 |
| InChI | InChI=1S/C33H44N6O3/c1-23(2)14-19-29-30(32(41-3)42-4)38(21-20-24-10-6-5-7-11-24)33(40)39(29)22-25-15-17-26(18-16-25)27-12-8-9-13-28(27)31-34-36-37-35-31/h8-9,12-13,15-18,23-24,32H,5-7,10-11,14,19-22H2,1-4H3,(H,34,35,36,37) |
| InChIKey | YZDDPCSMLILKKB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|