C29H37N7O — CID 70202044
2-(2-cyclohexylethyl)-5-pentyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one (PubChem CID 70202044) has the molecular formula C29H37N7O and a molecular weight of 499.66 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-5-pentyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 2-(2-cyclohexylethyl)-5-pentyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 70202044 |
| Molecular Formula | C29H37N7O |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 2-(2-cyclohexylethyl)-5-pentyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
| SMILES | CCCCCc1nn(CCC2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C29H37N7O/c1-2-3-5-14-27-32-36(20-19-22-10-6-4-7-11-22)29(37)35(27)21-23-15-17-24(18-16-23)25-12-8-9-13-26(25)28-30-33-34-31-28/h8-9,12-13,15-18,22H,2-7,10-11,14,19-21H2,1H3,(H,30,31,33,34) |
| InChIKey | SZYODCSLMHAJGF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|