C29H36ClN7O — CID 18384198
5-chloro-1-(2-cyclohexylethyl)-4-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]imidazol-2-one (PubChem CID 18384198) has the molecular formula C29H36ClN7O and a molecular weight of 534.11 g/mol. Its IUPAC name is 5-chloro-1-(2-cyclohexylethyl)-4-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 5-chloro-1-(2-cyclohexylethyl)-4-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 18384198 |
| Molecular Formula | C29H36ClN7O |
| Molecular Weight | 534.11 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 5-chloro-1-(2-cyclohexylethyl)-4-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]imidazol-2-one |
| SMILES | CCCCCc1c(Cl)n(CCC2CCCCC2)c(=O)n1Cc1ccc(-c2cccnc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C29H36ClN7O/c1-2-3-5-12-25-27(30)36(19-17-21-9-6-4-7-10-21)29(38)37(25)20-22-13-15-23(16-14-22)24-11-8-18-31-26(24)28-32-34-35-33-28/h8,11,13-16,18,21H,2-7,9-10,12,17,19-20H2,1H3,(H,32,33,34,35) |
| InChIKey | RVCDNIGQJLQMDX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.11 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|