C29H39N7O — CID 70199735
2-heptyl-5-hexyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one (PubChem CID 70199735) has the molecular formula C29H39N7O and a molecular weight of 501.68 g/mol. Its IUPAC name is 2-heptyl-5-hexyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 2-heptyl-5-hexyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 70199735 |
| Molecular Formula | C29H39N7O |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | 2-heptyl-5-hexyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
| SMILES | CCCCCCCn1nc(CCCCCC)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c1=O |
| InChI | InChI=1S/C29H39N7O/c1-3-5-7-9-13-21-36-29(37)35(27(32-36)16-10-8-6-4-2)22-23-17-19-24(20-18-23)25-14-11-12-15-26(25)28-30-33-34-31-28/h11-12,14-15,17-20H,3-10,13,16,21-22H2,1-2H3,(H,30,31,33,34) |
| InChIKey | FEIFHRNVQIVFGL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|