C31H34N8O3 — CID 14956807
3-[3-butyl-5-oxo-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-1-yl]propyl N-methyl-N-phenylcarbamate (PubChem CID 14956807) has the molecular formula C31H34N8O3 and a molecular weight of 566.67 g/mol. Its IUPAC name is 3-[3-butyl-5-oxo-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-1-yl]propyl N-methyl-N-phenylcarbamate.
| Compound Name | 3-[3-butyl-5-oxo-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-1-yl]propyl N-methyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 14956807 |
| Molecular Formula | C31H34N8O3 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 3-[3-butyl-5-oxo-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-1-yl]propyl N-methyl-N-phenylcarbamate |
| SMILES | CCCCc1nn(CCCOC(=O)N(C)c2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H34N8O3/c1-3-4-15-28-34-39(20-10-21-42-31(41)37(2)25-11-6-5-7-12-25)30(40)38(28)22-23-16-18-24(19-17-23)26-13-8-9-14-27(26)29-32-35-36-33-29/h5-9,11-14,16-19H,3-4,10,15,20-22H2,1-2H3,(H,32,33,35,36) |
| InChIKey | ZWAXWUPHYATLOF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|