C26H30N2O3 — CID 135892621
2-[4-[(2,4-dibutyl-6-oxo-1H-pyrimidin-5-yl)methyl]phenyl]benzoic acid (PubChem CID 135892621) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[4-[(2,4-dibutyl-6-oxo-1H-pyrimidin-5-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(2,4-dibutyl-6-oxo-1H-pyrimidin-5-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 135892621 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-[4-[(2,4-dibutyl-6-oxo-1H-pyrimidin-5-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCc1nc(CCCC)c(Cc2ccc(-c3ccccc3C(=O)O)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C26H30N2O3/c1-3-5-11-23-22(25(29)28-24(27-23)12-6-4-2)17-18-13-15-19(16-14-18)20-9-7-8-10-21(20)26(30)31/h7-10,13-16H,3-6,11-12,17H2,1-2H3,(H,30,31)(H,27,28,29) |
| InChIKey | UYIBJQZNRMQVOZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |