C24H25N3O — CID 135503723
2-[4-[(6-oxo-2,4-dipropyl-1H-pyrimidin-5-yl)methyl]phenyl]benzonitrile (PubChem CID 135503723) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[4-[(6-oxo-2,4-dipropyl-1H-pyrimidin-5-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(6-oxo-2,4-dipropyl-1H-pyrimidin-5-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 135503723 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-[4-[(6-oxo-2,4-dipropyl-1H-pyrimidin-5-yl)methyl]phenyl]benzonitrile |
| SMILES | CCCc1nc(CCC)c(Cc2ccc(-c3ccccc3C#N)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H25N3O/c1-3-7-22-21(24(28)27-23(26-22)8-4-2)15-17-11-13-18(14-12-17)20-10-6-5-9-19(20)16-25/h5-6,9-14H,3-4,7-8,15H2,1-2H3,(H,26,27,28) |
| InChIKey | BZWOVRCWGKYFAR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |