C29H27N3O — CID 57460356
2-[4-[(2-ethyl-6-oxo-1-phenyl-4-propylpyrimidin-5-yl)methyl]phenyl]benzonitrile (PubChem CID 57460356) has the molecular formula C29H27N3O and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[4-[(2-ethyl-6-oxo-1-phenyl-4-propylpyrimidin-5-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(2-ethyl-6-oxo-1-phenyl-4-propylpyrimidin-5-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 57460356 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-[4-[(2-ethyl-6-oxo-1-phenyl-4-propylpyrimidin-5-yl)methyl]phenyl]benzonitrile |
| SMILES | CCCc1nc(CC)n(-c2ccccc2)c(=O)c1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C29H27N3O/c1-3-10-27-26(29(33)32(28(4-2)31-27)24-12-6-5-7-13-24)19-21-15-17-22(18-16-21)25-14-9-8-11-23(25)20-30/h5-9,11-18H,3-4,10,19H2,1-2H3 |
| InChIKey | BEEHVJIIZBXUPQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |