C29H25B2N3O2 — CID 88997482
CID 88997482 (PubChem CID 88997482) has the molecular formula C29H25B2N3O2 and a molecular weight of 469.16 g/mol.
| Compound Name | CID 88997482 |
|---|---|
| PubChem CID | 88997482 |
| Molecular Formula | C29H25B2N3O2 |
| Molecular Weight | 469.16 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])c1nc(CCC)c(Cc2ccc(-c3ccccc3C#N)cc2)c(=O)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H25B2N3O2/c1-3-6-26-25(17-19-9-11-20(12-10-19)24-8-5-4-7-21(24)18-32)29(35)34(28(33-26)27(30)31)22-13-15-23(36-2)16-14-22/h4-5,7-16,27H,3,6,17H2,1-2H3 |
| InChIKey | RXCOPMOXJKSTPS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|