C27H23N3O — CID 57460478
2-[4-[(4-ethyl-2-methyl-6-oxo-1-phenylpyrimidin-5-yl)methyl]phenyl]benzonitrile (PubChem CID 57460478) has the molecular formula C27H23N3O and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[4-[(4-ethyl-2-methyl-6-oxo-1-phenylpyrimidin-5-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(4-ethyl-2-methyl-6-oxo-1-phenylpyrimidin-5-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 57460478 |
| Molecular Formula | C27H23N3O |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-[4-[(4-ethyl-2-methyl-6-oxo-1-phenylpyrimidin-5-yl)methyl]phenyl]benzonitrile |
| SMILES | CCc1nc(C)n(-c2ccccc2)c(=O)c1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C27H23N3O/c1-3-26-25(27(31)30(19(2)29-26)23-10-5-4-6-11-23)17-20-13-15-21(16-14-20)24-12-8-7-9-22(24)18-28/h4-16H,3,17H2,1-2H3 |
| InChIKey | DDJVVPSATCFHBQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |