C23H22ClN3O — CID 10408172
2-[4-[[4-chloro-2-(methoxymethyl)-6-propylpyrimidin-5-yl]methyl]phenyl]benzonitrile (PubChem CID 10408172) has the molecular formula C23H22ClN3O and a molecular weight of 391.90 g/mol. Its IUPAC name is 2-[4-[[4-chloro-2-(methoxymethyl)-6-propylpyrimidin-5-yl]methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[[4-chloro-2-(methoxymethyl)-6-propylpyrimidin-5-yl]methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 10408172 |
| Molecular Formula | C23H22ClN3O |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-[4-[[4-chloro-2-(methoxymethyl)-6-propylpyrimidin-5-yl]methyl]phenyl]benzonitrile |
| SMILES | CCCc1nc(COC)nc(Cl)c1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C23H22ClN3O/c1-3-6-21-20(23(24)27-22(26-21)15-28-2)13-16-9-11-17(12-10-16)19-8-5-4-7-18(19)14-25/h4-5,7-12H,3,6,13,15H2,1-2H3 |
| InChIKey | QRXLNCAWOUXJPT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |