C25H25N3 — CID 67941130
2-[4-[(4-butyl-6-ethenyl-2-methylpyrimidin-5-yl)methyl]phenyl]benzonitrile (PubChem CID 67941130) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-[4-[(4-butyl-6-ethenyl-2-methylpyrimidin-5-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(4-butyl-6-ethenyl-2-methylpyrimidin-5-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 67941130 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-[4-[(4-butyl-6-ethenyl-2-methylpyrimidin-5-yl)methyl]phenyl]benzonitrile |
| SMILES | C=Cc1nc(C)nc(CCCC)c1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C25H25N3/c1-4-6-11-25-23(24(5-2)27-18(3)28-25)16-19-12-14-20(15-13-19)22-10-8-7-9-21(22)17-26/h5,7-10,12-15H,2,4,6,11,16H2,1,3H3 |
| InChIKey | FQDRSBQZYGTCSZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |