C24H26N4O4S — CID 135556644
2-[4-[[4-butyl-2-(methylaminosulfanylcarbonylamino)-6-oxo-1H-pyrimidin-5-yl]methyl]phenyl]benzoic acid (PubChem CID 135556644) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[4-[[4-butyl-2-(methylaminosulfanylcarbonylamino)-6-oxo-1H-pyrimidin-5-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[4-butyl-2-(methylaminosulfanylcarbonylamino)-6-oxo-1H-pyrimidin-5-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 135556644 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-[4-[[4-butyl-2-(methylaminosulfanylcarbonylamino)-6-oxo-1H-pyrimidin-5-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCc1nc(NC(=O)SNC)[nH]c(=O)c1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-3-4-9-20-19(21(29)27-23(26-20)28-24(32)33-25-2)14-15-10-12-16(13-11-15)17-7-5-6-8-18(17)22(30)31/h5-8,10-13,25H,3-4,9,14H2,1-2H3,(H,30,31)(H2,26,27,28,29,32) |
| InChIKey | ISEMFSDEKNIVIA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|