C24H26N2O4 — CID 19740831
2-[4-[(5-butan-2-yl-2-oxo-3-propanoyl-1H-imidazol-4-yl)methyl]phenyl]benzoic acid (PubChem CID 19740831) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[4-[(5-butan-2-yl-2-oxo-3-propanoyl-1H-imidazol-4-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(5-butan-2-yl-2-oxo-3-propanoyl-1H-imidazol-4-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19740831 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[4-[(5-butan-2-yl-2-oxo-3-propanoyl-1H-imidazol-4-yl)methyl]phenyl]benzoic acid |
| SMILES | CCC(=O)n1c(Cc2ccc(-c3ccccc3C(=O)O)cc2)c(C(C)CC)[nH]c1=O |
| InChI | InChI=1S/C24H26N2O4/c1-4-15(3)22-20(26(21(27)5-2)24(30)25-22)14-16-10-12-17(13-11-16)18-8-6-7-9-19(18)23(28)29/h6-13,15H,4-5,14H2,1-3H3,(H,25,30)(H,28,29) |
| InChIKey | REZSNFTZSFOZML-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |